C9H12N2S2 — CID 2730103
1-cyclopropyl-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 2730103) has the molecular formula C9H12N2S2 and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-cyclopropyl-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-cyclopropyl-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2730103 |
| Molecular Formula | C9H12N2S2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1-cyclopropyl-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | S=C(NCc1cccs1)NC1CC1 |
| InChI | InChI=1S/C9H12N2S2/c12-9(11-7-3-4-7)10-6-8-2-1-5-13-8/h1-2,5,7H,3-4,6H2,(H2,10,11,12) |
| InChIKey | IGXLXPKSPCGRJU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|