C13H20N2S2 — CID 46800412
1-(2-methylcyclohexyl)-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 46800412) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-(2-methylcyclohexyl)-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-(2-methylcyclohexyl)-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 46800412 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-(2-methylcyclohexyl)-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | CC1CCCCC1NC(=S)NCc1cccs1 |
| InChI | InChI=1S/C13H20N2S2/c1-10-5-2-3-7-12(10)15-13(16)14-9-11-6-4-8-17-11/h4,6,8,10,12H,2-3,5,7,9H2,1H3,(H2,14,15,16) |
| InChIKey | VSPYGZWXBLHUFS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|