C13H18N2OS2 — CID 2381843
N-[[(1R,2S)-2-methylcyclohexyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 2381843) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[[(1R,2S)-2-methylcyclohexyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[(1R,2S)-2-methylcyclohexyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2381843 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-[[(1R,2S)-2-methylcyclohexyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)NC(=O)c1cccs1 |
| InChI | InChI=1S/C13H18N2OS2/c1-9-5-2-3-6-10(9)14-13(17)15-12(16)11-7-4-8-18-11/h4,7-10H,2-3,5-6H2,1H3,(H2,14,15,16,17)/t9-,10+/m0/s1 |
| InChIKey | VKIZTLLBEBMLGG-VHSXEESVSA-N |
| XLogP | 2.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|