C14H19NOS — CID 92909639
(Z)-N-[(1S,2R)-2-methylcyclohexyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 92909639) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is (Z)-N-[(1S,2R)-2-methylcyclohexyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (Z)-N-[(1S,2R)-2-methylcyclohexyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 92909639 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (Z)-N-[(1S,2R)-2-methylcyclohexyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)/C=C\c1cccs1 |
| InChI | InChI=1S/C14H19NOS/c1-11-5-2-3-7-13(11)15-14(16)9-8-12-6-4-10-17-12/h4,6,8-11,13H,2-3,5,7H2,1H3,(H,15,16)/b9-8-/t11-,13+/m1/s1 |
| InChIKey | PLSHPWORDTXRNN-UUZNHUNUSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|