C16H15NOS2 — CID 8899095
(E)-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 8899095) has the molecular formula C16H15NOS2 and a molecular weight of 301.44 g/mol. Its IUPAC name is (E)-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 8899095 |
| Molecular Formula | C16H15NOS2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (E)-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)N[C@@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C16H15NOS2/c18-16(8-7-12-4-3-10-19-12)17-14-9-11-20-15-6-2-1-5-13(14)15/h1-8,10,14H,9,11H2,(H,17,18)/b8-7+/t14-/m1/s1 |
| InChIKey | BDWBQVUKDUDBMM-HSBSLETESA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|