C18H16FNOS — CID 7678621
(E)-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 7678621) has the molecular formula C18H16FNOS and a molecular weight of 313.40 g/mol. Its IUPAC name is (E)-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7678621 |
| Molecular Formula | C18H16FNOS |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (E)-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)N[C@@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C18H16FNOS/c19-14-8-5-13(6-9-14)7-10-18(21)20-16-11-12-22-17-4-2-1-3-15(16)17/h1-10,16H,11-12H2,(H,20,21)/b10-7+/t16-/m1/s1 |
| InChIKey | CGFGJKVQQFJLEA-OJXHRBAXSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|