C19H17ClFNO2S — CID 46524362
(E)-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide (PubChem CID 46524362) has the molecular formula C19H17ClFNO2S and a molecular weight of 377.87 g/mol. Its IUPAC name is (E)-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46524362 |
| Molecular Formula | C19H17ClFNO2S |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (E)-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC2CCSc3ccc(Cl)cc32)cc1F |
| InChI | InChI=1S/C19H17ClFNO2S/c1-24-17-5-2-12(10-15(17)21)3-7-19(23)22-16-8-9-25-18-6-4-13(20)11-14(16)18/h2-7,10-11,16H,8-9H2,1H3,(H,22,23)/b7-3+ |
| InChIKey | UPYMWZXBYBECJV-XVNBXDOJSA-N |
| XLogP | 4.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|