C21H20ClNO5 — CID 108764762
[4-[(E)-3-[(6-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 108764762) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is [4-[(E)-3-[(6-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(E)-3-[(6-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 108764762 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [4-[(E)-3-[(6-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)NC2CCOc3ccc(Cl)cc32)ccc1OC(C)=O |
| InChI | InChI=1S/C21H20ClNO5/c1-13(24)28-19-6-3-14(11-20(19)26-2)4-8-21(25)23-17-9-10-27-18-7-5-15(22)12-16(17)18/h3-8,11-12,17H,9-10H2,1-2H3,(H,23,25)/b8-4+ |
| InChIKey | PWMRTLAAUVLXJF-XBXARRHUSA-N |
| XLogP | 3.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|