C23H27NO5 — CID 99996975
(E)-3-(3,4-dimethoxyphenyl)-N-[(4S)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]prop-2-enamide (PubChem CID 99996975) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[(4S)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[(4S)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 99996975 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[(4S)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]prop-2-enamide |
| SMILES | COc1ccc2c(c1)[C@@H](NC(=O)/C=C/c1ccc(OC)c(OC)c1)CC(C)(C)O2 |
| InChI | InChI=1S/C23H27NO5/c1-23(2)14-18(17-13-16(26-3)8-10-19(17)29-23)24-22(25)11-7-15-6-9-20(27-4)21(12-15)28-5/h6-13,18H,14H2,1-5H3,(H,24,25)/b11-7+/t18-/m0/s1 |
| InChIKey | UCVYIQZSJXGVHC-DBEXCURXSA-N |
| XLogP | 4.14 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|