C21H22N2O4 — CID 132654779
(E)-3-(4-nitrophenyl)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)prop-2-enamide (PubChem CID 132654779) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-nitrophenyl)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 132654779 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)prop-2-enamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)CC(C)(C)O2 |
| InChI | InChI=1S/C21H22N2O4/c1-14-4-10-19-17(12-14)18(13-21(2,3)27-19)22-20(24)11-7-15-5-8-16(9-6-15)23(25)26/h4-12,18H,13H2,1-3H3,(H,22,24)/b11-7+ |
| InChIKey | OBXHELXQTSVZEH-YRNVUSSQSA-N |
| XLogP | 4.34 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|