C22H23NO2 — CID 143840043
(E)-3-(4-methylphenyl)-N-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ylprop-2-enamide (PubChem CID 143840043) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (E)-3-(4-methylphenyl)-N-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ylprop-2-enamide.
| Compound Name | (E)-3-(4-methylphenyl)-N-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 143840043 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (E)-3-(4-methylphenyl)-N-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ylprop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC2CC3(CCC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C22H23NO2/c1-16-7-9-17(10-8-16)11-12-21(24)23-19-15-22(13-4-14-22)25-20-6-3-2-5-18(19)20/h2-3,5-12,19H,4,13-15H2,1H3,(H,23,24)/b12-11+ |
| InChIKey | UESROUPGDPUDMK-VAWYXSNFSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|