C20H20N2O4 — CID 132653130
(E)-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 132653130) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (E)-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 132653130 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (E)-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CC1(C)CC(NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)c2ccccc2O1 |
| InChI | InChI=1S/C20H20N2O4/c1-20(2)13-17(16-5-3-4-6-18(16)26-20)21-19(23)12-9-14-7-10-15(11-8-14)22(24)25/h3-12,17H,13H2,1-2H3,(H,21,23)/b12-9+ |
| InChIKey | BGANJKFILKYHQI-FMIVXFBMSA-N |
| XLogP | 4.03 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|