C21H22ClNO2 — CID 132653752
(E)-3-(4-chlorophenyl)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)prop-2-enamide (PubChem CID 132653752) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 132653752 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)prop-2-enamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)/C=C/c1ccc(Cl)cc1)CC(C)(C)O2 |
| InChI | InChI=1S/C21H22ClNO2/c1-14-4-10-19-17(12-14)18(13-21(2,3)25-19)23-20(24)11-7-15-5-8-16(22)9-6-15/h4-12,18H,13H2,1-3H3,(H,23,24)/b11-7+ |
| InChIKey | LKGNHNXBNPWVBP-YRNVUSSQSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|