C19H19ClFNO2 — CID 133201576
4-chloro-2-fluoro-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)benzamide (PubChem CID 133201576) has the molecular formula C19H19ClFNO2 and a molecular weight of 347.82 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)benzamide.
| Compound Name | 4-chloro-2-fluoro-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)benzamide |
|---|---|
| PubChem CID | 133201576 |
| Molecular Formula | C19H19ClFNO2 |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-chloro-2-fluoro-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)benzamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)c1ccc(Cl)cc1F)CC(C)(C)O2 |
| InChI | InChI=1S/C19H19ClFNO2/c1-11-4-7-17-14(8-11)16(10-19(2,3)24-17)22-18(23)13-6-5-12(20)9-15(13)21/h4-9,16H,10H2,1-3H3,(H,22,23) |
| InChIKey | NGSHFOVDHRJPHB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |