C19H20ClNO2 — CID 132651440
3-chloro-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)benzamide (PubChem CID 132651440) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 3-chloro-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)benzamide.
| Compound Name | 3-chloro-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)benzamide |
|---|---|
| PubChem CID | 132651440 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-chloro-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)benzamide |
| SMILES | Cc1ccc2c(c1)OC(C)(C)CC2NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClNO2/c1-12-7-8-15-16(11-19(2,3)23-17(15)9-12)21-18(22)13-5-4-6-14(20)10-13/h4-10,16H,11H2,1-3H3,(H,21,22) |
| InChIKey | YEXQTHIEILZQNU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |