C22H23NO5 — CID 99997222
(E)-3-(1,3-benzodioxol-5-yl)-N-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]prop-2-enamide (PubChem CID 99997222) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 99997222 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]prop-2-enamide |
| SMILES | COc1ccc2c(c1)[C@H](NC(=O)/C=C/c1ccc3c(c1)OCO3)CC(C)(C)O2 |
| InChI | InChI=1S/C22H23NO5/c1-22(2)12-17(16-11-15(25-3)6-8-18(16)28-22)23-21(24)9-5-14-4-7-19-20(10-14)27-13-26-19/h4-11,17H,12-13H2,1-3H3,(H,23,24)/b9-5+/t17-/m1/s1 |
| InChIKey | PEXBYQWPUWZDNP-HFTQHKIXSA-N |
| XLogP | 3.86 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|