C16H24N2O3 — CID 100748889
1-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-propylurea (PubChem CID 100748889) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-propylurea.
| Compound Name | 1-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-propylurea |
|---|---|
| PubChem CID | 100748889 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-propylurea |
| SMILES | CCCNC(=O)N[C@@H]1CC(C)(C)Oc2ccc(OC)cc21 |
| InChI | InChI=1S/C16H24N2O3/c1-5-8-17-15(19)18-13-10-16(2,3)21-14-7-6-11(20-4)9-12(13)14/h6-7,9,13H,5,8,10H2,1-4H3,(H2,17,18,19)/t13-/m1/s1 |
| InChIKey | AMNNBYMZNWGVBH-CYBMUJFWSA-N |
| XLogP | 3.01 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |