C14H19ClN2O2 — CID 11208334
1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-ethylurea (PubChem CID 11208334) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-ethylurea.
| Compound Name | 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-ethylurea |
|---|---|
| PubChem CID | 11208334 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-ethylurea |
| SMILES | CCNC(=O)NC1CC(C)(C)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H19ClN2O2/c1-4-16-13(18)17-11-8-14(2,3)19-12-6-5-9(15)7-10(11)12/h5-7,11H,4,8H2,1-3H3,(H2,16,17,18) |
| InChIKey | MYGMVHZKQFXNDC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |