C21H24N4O2 — CID 171140030
3-(2-aminopyrimidin-5-yl)-N-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ylprop-2-enamide (PubChem CID 171140030) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-(2-aminopyrimidin-5-yl)-N-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ylprop-2-enamide.
| Compound Name | 3-(2-aminopyrimidin-5-yl)-N-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 171140030 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-(2-aminopyrimidin-5-yl)-N-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ylprop-2-enamide |
| SMILES | Nc1ncc(C=CC(=O)NC2CC3(CCCCC3)Oc3ccccc32)cn1 |
| InChI | InChI=1S/C21H24N4O2/c22-20-23-13-15(14-24-20)8-9-19(26)25-17-12-21(10-4-1-5-11-21)27-18-7-3-2-6-16(17)18/h2-3,6-9,13-14,17H,1,4-5,10-12H2,(H,25,26)(H2,22,23,24) |
| InChIKey | YJAGBNCKWSIUNI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|