C18H26N2O2 — CID 126468272
1-propyl-3-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ylurea (PubChem CID 126468272) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-propyl-3-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ylurea.
| Compound Name | 1-propyl-3-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ylurea |
|---|---|
| PubChem CID | 126468272 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-propyl-3-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ylurea |
| SMILES | CCCNC(=O)NC1CC2(CCCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C18H26N2O2/c1-2-12-19-17(21)20-15-13-18(10-6-3-7-11-18)22-16-9-5-4-8-14(15)16/h4-5,8-9,15H,2-3,6-7,10-13H2,1H3,(H2,19,20,21) |
| InChIKey | ZUHIPYWTEZBHMV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |