C18H23N5O3 — CID 137148252
1-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]-3-[(4R)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-yl]urea (PubChem CID 137148252) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]-3-[(4R)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-yl]urea.
| Compound Name | 1-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]-3-[(4R)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-yl]urea |
|---|---|
| PubChem CID | 137148252 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]-3-[(4R)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-yl]urea |
| SMILES | O=C(NCc1n[nH]c(=O)[nH]1)N[C@@H]1CC2(CCCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C18H23N5O3/c24-16(19-11-15-21-17(25)23-22-15)20-13-10-18(8-4-1-5-9-18)26-14-7-3-2-6-12(13)14/h2-3,6-7,13H,1,4-5,8-11H2,(H2,19,20,24)(H2,21,22,23,25)/t13-/m1/s1 |
| InChIKey | YTCVOZMODACNER-CYBMUJFWSA-N |
| XLogP | 2.12 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |