C18H18BrN3O3S — CID 11604515
1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-nitrophenyl)thiourea (PubChem CID 11604515) has the molecular formula C18H18BrN3O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 11604515 |
| Molecular Formula | C18H18BrN3O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 1-(6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-nitrophenyl)thiourea |
| SMILES | CC1(C)CC(NC(=S)Nc2ccc([N+](=O)[O-])cc2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C18H18BrN3O3S/c1-18(2)10-15(14-9-11(19)3-8-16(14)25-18)21-17(26)20-12-4-6-13(7-5-12)22(23)24/h3-9,15H,10H2,1-2H3,(H2,20,21,26) |
| InChIKey | WVQRNYQXPPQDMD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|