C22H24N4O3S — CID 162663035
ethyl N-[4-[(4-cyanophenyl)carbamothioylamino]-2,2-dimethyl-3,4-dihydrochromen-6-yl]carbamate (PubChem CID 162663035) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is ethyl N-[4-[(4-cyanophenyl)carbamothioylamino]-2,2-dimethyl-3,4-dihydrochromen-6-yl]carbamate.
| Compound Name | ethyl N-[4-[(4-cyanophenyl)carbamothioylamino]-2,2-dimethyl-3,4-dihydrochromen-6-yl]carbamate |
|---|---|
| PubChem CID | 162663035 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | ethyl N-[4-[(4-cyanophenyl)carbamothioylamino]-2,2-dimethyl-3,4-dihydrochromen-6-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)C(NC(=S)Nc1ccc(C#N)cc1)CC(C)(C)O2 |
| InChI | InChI=1S/C22H24N4O3S/c1-4-28-21(27)25-16-9-10-19-17(11-16)18(12-22(2,3)29-19)26-20(30)24-15-7-5-14(13-23)6-8-15/h5-11,18H,4,12H2,1-3H3,(H,25,27)(H2,24,26,30) |
| InChIKey | SRDOBFYRIDRJEX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|