C18H14Cl3NO2 — CID 108764745
(E)-N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 108764745) has the molecular formula C18H14Cl3NO2 and a molecular weight of 382.67 g/mol. Its IUPAC name is (E)-N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108764745 |
| Molecular Formula | C18H14Cl3NO2 |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | (E)-N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H14Cl3NO2/c19-12-4-5-17-14(9-12)16(7-8-24-17)22-18(23)6-2-11-1-3-13(20)10-15(11)21/h1-6,9-10,16H,7-8H2,(H,22,23)/b6-2+ |
| InChIKey | QVMBCZYRWZOHDM-QHHAFSJGSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|