C16H11ClF3NO2 — CID 108742241
N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-2,3,4-trifluorobenzamide (PubChem CID 108742241) has the molecular formula C16H11ClF3NO2 and a molecular weight of 341.72 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-2,3,4-trifluorobenzamide.
| Compound Name | N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108742241 |
| Molecular Formula | C16H11ClF3NO2 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-2,3,4-trifluorobenzamide |
| SMILES | O=C(NC1CCOc2ccc(Cl)cc21)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H11ClF3NO2/c17-8-1-4-13-10(7-8)12(5-6-23-13)21-16(22)9-2-3-11(18)15(20)14(9)19/h1-4,7,12H,5-6H2,(H,21,22) |
| InChIKey | DWAFTBGOEOEZRX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|