C15H10F3NO2 — CID 110751620
N-(2,3-dihydro-1-benzofuran-3-yl)-2,3,4-trifluorobenzamide (PubChem CID 110751620) has the molecular formula C15H10F3NO2 and a molecular weight of 293.24 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-3-yl)-2,3,4-trifluorobenzamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-3-yl)-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 110751620 |
| Molecular Formula | C15H10F3NO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-3-yl)-2,3,4-trifluorobenzamide |
| SMILES | O=C(NC1COc2ccccc21)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H10F3NO2/c16-10-6-5-9(13(17)14(10)18)15(20)19-11-7-21-12-4-2-1-3-8(11)12/h1-6,11H,7H2,(H,19,20) |
| InChIKey | BJFCBNZSNNWIFG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|