C15H11BrFNO2 — CID 103707167
3-bromo-N-(2,3-dihydro-1-benzofuran-3-yl)-4-fluorobenzamide (PubChem CID 103707167) has the molecular formula C15H11BrFNO2 and a molecular weight of 336.16 g/mol. Its IUPAC name is 3-bromo-N-(2,3-dihydro-1-benzofuran-3-yl)-4-fluorobenzamide.
| Compound Name | 3-bromo-N-(2,3-dihydro-1-benzofuran-3-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 103707167 |
| Molecular Formula | C15H11BrFNO2 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 3-bromo-N-(2,3-dihydro-1-benzofuran-3-yl)-4-fluorobenzamide |
| SMILES | O=C(NC1COc2ccccc21)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H11BrFNO2/c16-11-7-9(5-6-12(11)17)15(19)18-13-8-20-14-4-2-1-3-10(13)14/h1-7,13H,8H2,(H,18,19) |
| InChIKey | GKUAKXDBDMOTCO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |