C15H12ClNO2 — CID 110751613
4-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)benzamide (PubChem CID 110751613) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)benzamide.
| Compound Name | 4-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)benzamide |
|---|---|
| PubChem CID | 110751613 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 4-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)benzamide |
| SMILES | O=C(NC1COc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClNO2/c16-11-7-5-10(6-8-11)15(18)17-13-9-19-14-4-2-1-3-12(13)14/h1-8,13H,9H2,(H,17,18) |
| InChIKey | ODXWJNBESBXGSW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |