C16H14ClNO2 — CID 110751510
4-chloro-N-(3,4-dihydro-2H-chromen-3-yl)benzamide (PubChem CID 110751510) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 4-chloro-N-(3,4-dihydro-2H-chromen-3-yl)benzamide.
| Compound Name | 4-chloro-N-(3,4-dihydro-2H-chromen-3-yl)benzamide |
|---|---|
| PubChem CID | 110751510 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-chloro-N-(3,4-dihydro-2H-chromen-3-yl)benzamide |
| SMILES | O=C(NC1COc2ccccc2C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClNO2/c17-13-7-5-11(6-8-13)16(19)18-14-9-12-3-1-2-4-15(12)20-10-14/h1-8,14H,9-10H2,(H,18,19) |
| InChIKey | OIWOXPYLFIEYFV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |