C19H20ClNO2 — CID 87017830
4-(4-chlorophenyl)-N-(3,4-dihydro-2H-chromen-3-yl)butanamide (PubChem CID 87017830) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(3,4-dihydro-2H-chromen-3-yl)butanamide.
| Compound Name | 4-(4-chlorophenyl)-N-(3,4-dihydro-2H-chromen-3-yl)butanamide |
|---|---|
| PubChem CID | 87017830 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(3,4-dihydro-2H-chromen-3-yl)butanamide |
| SMILES | O=C(CCCc1ccc(Cl)cc1)NC1COc2ccccc2C1 |
| InChI | InChI=1S/C19H20ClNO2/c20-16-10-8-14(9-11-16)4-3-7-19(22)21-17-12-15-5-1-2-6-18(15)23-13-17/h1-2,5-6,8-11,17H,3-4,7,12-13H2,(H,21,22) |
| InChIKey | NZHMYJNMPYBJCR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |