C15H14ClN3O2 — CID 63933528
2-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)-6-(methylamino)pyridine-4-carboxamide (PubChem CID 63933528) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)-6-(methylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)-6-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 63933528 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)-6-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)NC2COc3ccccc32)cc(Cl)n1 |
| InChI | InChI=1S/C15H14ClN3O2/c1-17-14-7-9(6-13(16)19-14)15(20)18-11-8-21-12-5-3-2-4-10(11)12/h2-7,11H,8H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | XRJKTFJBQLEOJF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|