C14H20ClN3O — CID 62165625
2-chloro-N-cycloheptyl-6-(methylamino)pyridine-4-carboxamide (PubChem CID 62165625) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 2-chloro-N-cycloheptyl-6-(methylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-cycloheptyl-6-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62165625 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-chloro-N-cycloheptyl-6-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)NC2CCCCCC2)cc(Cl)n1 |
| InChI | InChI=1S/C14H20ClN3O/c1-16-13-9-10(8-12(15)18-13)14(19)17-11-6-4-2-3-5-7-11/h8-9,11H,2-7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | IEANRRNKTSOTBS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|