C9H10N2O2 — CID 62065035
2,3-dihydro-1-benzofuran-3-ylurea (PubChem CID 62065035) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-3-ylurea.
| Compound Name | 2,3-dihydro-1-benzofuran-3-ylurea |
|---|---|
| PubChem CID | 62065035 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-3-ylurea |
| SMILES | NC(=O)NC1COc2ccccc21 |
| InChI | InChI=1S/C9H10N2O2/c10-9(12)11-7-5-13-8-4-2-1-3-6(7)8/h1-4,7H,5H2,(H3,10,11,12) |
| InChIKey | BEONXGQURYTRDI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |