C16H15NO2 — CID 91653348
N-(2,3-dihydro-1-benzofuran-3-yl)-2-prop-2-ynylpent-4-ynamide (PubChem CID 91653348) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-3-yl)-2-prop-2-ynylpent-4-ynamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-3-yl)-2-prop-2-ynylpent-4-ynamide |
|---|---|
| PubChem CID | 91653348 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-3-yl)-2-prop-2-ynylpent-4-ynamide |
| SMILES | C#CCC(CC#C)C(=O)NC1COc2ccccc21 |
| InChI | InChI=1S/C16H15NO2/c1-3-7-12(8-4-2)16(18)17-14-11-19-15-10-6-5-9-13(14)15/h1-2,5-6,9-10,12,14H,7-8,11H2,(H,17,18) |
| InChIKey | CGRDKEIYBYQSPB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|