C15H12FNO2S — CID 107030521
N-(2,3-dihydro-1-benzofuran-3-yl)-2-fluoro-5-sulfanylbenzamide (PubChem CID 107030521) has the molecular formula C15H12FNO2S and a molecular weight of 289.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-3-yl)-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-3-yl)-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107030521 |
| Molecular Formula | C15H12FNO2S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-3-yl)-2-fluoro-5-sulfanylbenzamide |
| SMILES | O=C(NC1COc2ccccc21)c1cc(S)ccc1F |
| InChI | InChI=1S/C15H12FNO2S/c16-12-6-5-9(20)7-11(12)15(18)17-13-8-19-14-4-2-1-3-10(13)14/h1-7,13,20H,8H2,(H,17,18) |
| InChIKey | TZTNJBBLZHYIQR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|