C16H14ClNO2S — CID 107028267
2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-5-sulfanylbenzamide (PubChem CID 107028267) has the molecular formula C16H14ClNO2S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107028267 |
| Molecular Formula | C16H14ClNO2S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-5-sulfanylbenzamide |
| SMILES | O=C(NC1CCOc2ccccc21)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C16H14ClNO2S/c17-13-6-5-10(21)9-12(13)16(19)18-14-7-8-20-15-4-2-1-3-11(14)15/h1-6,9,14,21H,7-8H2,(H,18,19) |
| InChIKey | ZZZFVTOKCHNKEH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|