C17H16ClNO4S — CID 18193131
4-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-3-methylsulfonylbenzamide (PubChem CID 18193131) has the molecular formula C17H16ClNO4S and a molecular weight of 365.84 g/mol. Its IUPAC name is 4-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 18193131 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 4-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)NC2CCOc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C17H16ClNO4S/c1-24(21,22)16-10-11(6-7-13(16)18)17(20)19-14-8-9-23-15-5-3-2-4-12(14)15/h2-7,10,14H,8-9H2,1H3,(H,19,20) |
| InChIKey | CHOFVXBSRPDMND-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |