C18H16ClNO2 — CID 108757177
(E)-3-(2-chlorophenyl)-N-(3,4-dihydro-2H-chromen-4-yl)prop-2-enamide (PubChem CID 108757177) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(3,4-dihydro-2H-chromen-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(3,4-dihydro-2H-chromen-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108757177 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(3,4-dihydro-2H-chromen-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H16ClNO2/c19-15-7-3-1-5-13(15)9-10-18(21)20-16-11-12-22-17-8-4-2-6-14(16)17/h1-10,16H,11-12H2,(H,20,21)/b10-9+ |
| InChIKey | WQIXPICTOIDQMR-MDZDMXLPSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|