C9H11ClN2O — CID 53403029
(6-chloro-3,4-dihydro-2H-chromen-4-yl)hydrazine (PubChem CID 53403029) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is (6-chloro-3,4-dihydro-2H-chromen-4-yl)hydrazine.
| Compound Name | (6-chloro-3,4-dihydro-2H-chromen-4-yl)hydrazine |
|---|---|
| PubChem CID | 53403029 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (6-chloro-3,4-dihydro-2H-chromen-4-yl)hydrazine |
| SMILES | NNC1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H11ClN2O/c10-6-1-2-9-7(5-6)8(12-11)3-4-13-9/h1-2,5,8,12H,3-4,11H2 |
| InChIKey | UBEXSJZWLUUARV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|