C11H12ClNO2 — CID 110477139
N-(7-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)formamide (PubChem CID 110477139) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is N-(7-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)formamide.
| Compound Name | N-(7-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)formamide |
|---|---|
| PubChem CID | 110477139 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-(7-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)formamide |
| SMILES | O=CNC1CCCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H12ClNO2/c12-8-3-4-11-9(6-8)10(13-7-14)2-1-5-15-11/h3-4,6-7,10H,1-2,5H2,(H,13,14) |
| InChIKey | XEFJLTFBQRUOGT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|