C9H7ClO2 — CID 117201907
5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde (PubChem CID 117201907) has the molecular formula C9H7ClO2 and a molecular weight of 182.61 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde.
| Compound Name | 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 117201907 |
| Molecular Formula | C9H7ClO2 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde |
| SMILES | O=CC1COc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H7ClO2/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-4,6H,5H2 |
| InChIKey | ANSTWBGZNPLCQG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|