About 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde
5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde (PubChem CID 117201907) has the molecular formula C9H7ClO2
and a molecular weight of 182.61 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde |
| PubChem CID | 117201907 |
| Molecular Formula | C9H7ClO2 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde |
| SMILES | O=CC1COc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H7ClO2/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-4,6H,5H2 |
| InChIKey | ANSTWBGZNPLCQG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde?
The IUPAC name of 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde (CID 117201907) is 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde.
What is the SMILES notation for 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde?
The canonical SMILES for 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde is O=CC1COc2ccc(Cl)cc21.
What is the InChIKey of 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde?
The InChIKey is ANSTWBGZNPLCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO2/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-4,6H,5H2.
What are the key properties of 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde?
5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde has a molecular weight of 182.61 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dihydro-1-benzofuran-3-carbaldehyde is sourced from PubChem (CID 117201907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).