C9H7ClO — CID 105433250
3-chlorobicyclo[4.2.0]octa-1(6),2,4-triene-7-carbaldehyde (PubChem CID 105433250) has the molecular formula C9H7ClO and a molecular weight of 166.61 g/mol. Its IUPAC name is 3-chlorobicyclo[4.2.0]octa-1(6),2,4-triene-7-carbaldehyde.
| Compound Name | 3-chlorobicyclo[4.2.0]octa-1(6),2,4-triene-7-carbaldehyde |
|---|---|
| PubChem CID | 105433250 |
| Molecular Formula | C9H7ClO |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 3-chlorobicyclo[4.2.0]octa-1(6),2,4-triene-7-carbaldehyde |
| SMILES | O=CC1Cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H7ClO/c10-8-1-2-9-6(4-8)3-7(9)5-11/h1-2,4-5,7H,3H2 |
| InChIKey | FJZNBWNVFGKPBA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|