C10H11ClO — CID 141376286
5-chloro-2-methoxy-2,3-dihydro-1H-indene (PubChem CID 141376286) has the molecular formula C10H11ClO and a molecular weight of 182.65 g/mol. Its IUPAC name is 5-chloro-2-methoxy-2,3-dihydro-1H-indene.
| Compound Name | 5-chloro-2-methoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 141376286 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 5-chloro-2-methoxy-2,3-dihydro-1H-indene |
| SMILES | COC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C10H11ClO/c1-12-10-5-7-2-3-9(11)4-8(7)6-10/h2-4,10H,5-6H2,1H3 |
| InChIKey | RKLTZVHUDVTKJN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |