C12H16ClNO — CID 81301364
5-chloro-N-(2-methoxyethyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 81301364) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 5-chloro-N-(2-methoxyethyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-chloro-N-(2-methoxyethyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 81301364 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 5-chloro-N-(2-methoxyethyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | COCCNC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H16ClNO/c1-15-5-4-14-12-7-9-2-3-11(13)6-10(9)8-12/h2-3,6,12,14H,4-5,7-8H2,1H3 |
| InChIKey | OBSKYIPHCCABKO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|