C14H18ClN — CID 115890130
5-chloro-N-[(E)-pent-3-enyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 115890130) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is 5-chloro-N-[(E)-pent-3-enyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-chloro-N-[(E)-pent-3-enyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 115890130 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-chloro-N-[(E)-pent-3-enyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | C/C=C/CCNC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C14H18ClN/c1-2-3-4-7-16-14-9-11-5-6-13(15)8-12(11)10-14/h2-3,5-6,8,14,16H,4,7,9-10H2,1H3/b3-2+ |
| InChIKey | JIAIGRKUUJBLBE-NSCUHMNNSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|