C12H12ClN — CID 81300469
5-chloro-N-prop-2-ynyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 81300469) has the molecular formula C12H12ClN and a molecular weight of 205.69 g/mol. Its IUPAC name is 5-chloro-N-prop-2-ynyl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-chloro-N-prop-2-ynyl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 81300469 |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-chloro-N-prop-2-ynyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | C#CCNC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H12ClN/c1-2-5-14-12-7-9-3-4-11(13)6-10(9)8-12/h1,3-4,6,12,14H,5,7-8H2 |
| InChIKey | TWWYMXTTZVEUQI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|