C11H12ClNO2 — CID 138688043
7-chloro-4-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 138688043) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is 7-chloro-4-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-chloro-4-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 138688043 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 7-chloro-4-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | COC1CC(=O)Nc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C11H12ClNO2/c1-15-9-5-7-4-8(12)2-3-10(7)13-11(14)6-9/h2-4,9H,5-6H2,1H3,(H,13,14) |
| InChIKey | OVQBNSTZHOMVGU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |