C13H16ClNO3 — CID 161287321
6-chloro-3,4-dihydro-1H-quinolin-2-one;ethyl acetate (PubChem CID 161287321) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 6-chloro-3,4-dihydro-1H-quinolin-2-one;ethyl acetate.
| Compound Name | 6-chloro-3,4-dihydro-1H-quinolin-2-one;ethyl acetate |
|---|---|
| PubChem CID | 161287321 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-chloro-3,4-dihydro-1H-quinolin-2-one;ethyl acetate |
| SMILES | CCOC(C)=O.O=C1CCc2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C9H8ClNO.C4H8O2/c10-7-2-3-8-6(5-7)1-4-9(12)11-8;1-3-6-4(2)5/h2-3,5H,1,4H2,(H,11,12);3H2,1-2H3 |
| InChIKey | VFWVAZUINSSFPC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |