C11H12ClNO — CID 105463693
7-chloro-4-ethyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 105463693) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 7-chloro-4-ethyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-chloro-4-ethyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 105463693 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 7-chloro-4-ethyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCC1CC(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H12ClNO/c1-2-7-5-11(14)13-10-6-8(12)3-4-9(7)10/h3-4,6-7H,2,5H2,1H3,(H,13,14) |
| InChIKey | ISVLCPPLFGHNHX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |