C12H14FNO — CID 105460306
7-fluoro-4-propyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 105460306) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 7-fluoro-4-propyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-fluoro-4-propyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 105460306 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 7-fluoro-4-propyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCCC1CC(=O)Nc2cc(F)ccc21 |
| InChI | InChI=1S/C12H14FNO/c1-2-3-8-6-12(15)14-11-7-9(13)4-5-10(8)11/h4-5,7-8H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | QHJHEOJOIPIJLB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |